CAS 6425-66-7

1,2-bis(bromomethyl)-4-nitrobenzene

Description:

1,2-Bis(bromomethyl)-4-nitrobenzene is an organic compound characterized by its structure, which features a nitro group and two bromomethyl substituents on a benzene ring. This compound is typically a solid at room temperature and exhibits a yellow to brown color. It is known for its reactivity due to the presence of bromomethyl groups, which can participate in nucleophilic substitution reactions. The nitro group contributes to the compound's electron-withdrawing properties, influencing its reactivity and stability. 1,2-Bis(bromomethyl)-4-nitrobenzene is often used in organic synthesis, particularly in the preparation of more complex molecules and as an intermediate in various chemical reactions. It is important to handle this compound with care, as it may pose health risks, including toxicity and potential environmental hazards. Proper safety measures, including the use of personal protective equipment and adherence to safety protocols, are essential when working with this substance.

Formula: C₈H₇Br₂NO₂

InChI: InChI=1/C8H7Br2NO2/c9-4-6-1-2-8(11(12)13)3-7(6)5-10/h1-3H,4-5H2

SMILES: c1cc(cc(CBr)c1CBr)N(=O)=O

1,2-Bis(bromomethyl)-4-nitrobenzene

CAS: 6425-66-7

Formula: C₈H₇Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 308.9547

Ref: IN-DA00ECBJ

1,2-Bis(Bromomethyl)-4-Nitrobenzene

CAS: 6425-66-7

1,2-Bis(Bromomethyl)-4-Nitrobenzene

Purity: 98%

Molecular weight: 308.95g/mol

Ref: 54-OR1027886