CAS 64269-06-3
:1-(phenylamino)cyclohexanecarbonitrile
Description:
1-(Phenylamino)cyclohexanecarbonitrile, with the CAS number 64269-06-3, is an organic compound characterized by its cyclohexane ring substituted with both a phenylamino group and a carbonitrile functional group. This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline substance. The presence of the carbonitrile group (-C≡N) suggests that it may have polar characteristics, contributing to its solubility in polar solvents. The phenylamino group introduces aromatic properties, which can influence the compound's reactivity and interaction with other molecules. Additionally, the structure may exhibit potential biological activity, making it of interest in medicinal chemistry. Its synthesis and applications could be relevant in various fields, including pharmaceuticals and materials science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C13H16N2
InChI:InChI=1/C13H16N2/c14-11-13(9-5-2-6-10-13)15-12-7-3-1-4-8-12/h1,3-4,7-8,15H,2,5-6,9-10H2
SMILES:c1ccc(cc1)NC1(CCCCC1)C#N
Synonyms:- 1-Anilinocyclohexanecarbonitrile
- Cyclohexanecarbonitrile, 1-(Phenylamino)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Cyano-1-(phenylamino)cyclohexane
CAS:<p>1-Cyano-1-(phenylamino)cyclohexane</p>Purity:95%Molecular weight:200.28g/mol1-Cyano-1-(phenylamino)cyclohexane
CAS:<p>1-Cyano-1-(phenylamino)cyclohexane is a ketone that can be used as a nucleophile in organic synthesis. It is catalyzed by acid and has been shown to be effective in the reduction of various carbonyl groups. The reaction mechanism is based on the formation of an imine, followed by nucleophilic attack of the ketone on the imine. 1-Cyano-1-(phenylamino)cyclohexane also has magnetic properties and can be used in techniques such as magnetic resonance imaging (MRI). It is also useful for synthesizing nanostructured materials with aliphatic amines and amines. The yield for this reaction is about 30%.</p>Formula:C13H16N2Purity:Min. 95%Molecular weight:200.28 g/mol


