CAS 64270-99-1

(1R)-1-(5-methylfuran-2-yl)ethanaminium

Description:

(1R)-1-(5-methylfuran-2-yl)ethanaminium, with the CAS number 64270-99-1, is an organic compound characterized by its amine functional group and a furan ring structure. This compound features a chiral center, which contributes to its stereochemistry, specifically the (1R) configuration. The presence of the 5-methylfuran moiety imparts unique electronic and steric properties, influencing its reactivity and potential applications. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The amine group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for various synthetic modifications, which could enhance its properties or lead to derivatives with improved efficacy. Overall, (1R)-1-(5-methylfuran-2-yl)ethanaminium represents a class of compounds that bridge organic chemistry and pharmacology, warranting further investigation into its characteristics and applications.

Formula: C₇H₁₂NO

InChI: InChI=1/C7H11NO/c1-5-3-4-7(9-5)6(2)8/h3-4,6H,8H2,1-2H3/p+1/t6-/m1/s1

1-(5-Methyl-furan-2-yl)-ethylamine

CAS: 64270-99-1

Formula: C₇H₁₁NO

Molecular weight: 125.1683

Ref: IN-DA00EDW7

1-(5-Methylfuran-2-yl)ethylamine

CAS: 64270-99-1

Formula: C₇H₁₁NO

Purity: 95.0%

Molecular weight: 125.171

Ref: 10-F037842

1-(5-Methylfuran-2-yl)ethylamine

CAS: 64270-99-1

Versatile small molecule scaffold

Formula: C₇H₁₁NO

Purity: Min. 95%

Molecular weight: 125.17 g/mol

Ref: 3D-PCA27099