CAS 64285-95-6
:(4-(trifluoromethoxy)phenyl)isothiocyanate
Description:
(4-(Trifluoromethoxy)phenyl)isothiocyanate is an organic compound characterized by the presence of both isothiocyanate and trifluoromethoxy functional groups. Its molecular structure features a phenyl ring substituted at the para position with a trifluoromethoxy group, which enhances its reactivity and solubility in organic solvents. The isothiocyanate functional group (-N=C=S) is known for its versatility in chemical reactions, particularly in the synthesis of thioureas and other nitrogen-containing compounds. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate to high toxicity, necessitating careful handling and storage. Its unique electronic properties, influenced by the trifluoromethoxy group, can affect its reactivity and interactions with biological systems, making it of interest in medicinal chemistry and agrochemical applications. Additionally, it may serve as a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals, highlighting its significance in chemical research and development.
Formula:C8H4F3NOS
InChI:InChI=1/C8H4F3NO2S/c9-8(10,11)14-6-1-3-7(4-2-6)15-12-5-13/h1-4H
SMILES:c1cc(ccc1OC(F)(F)F)SN=C=O
Synonyms:- 4-(Trifluoromethoxy)phenylisothiocyanate
- 4-(Trifluoromethoxy)phenyl Isothiocyanate
- 4-(Trifluoromethoxy)phenyl isothiocyanate 97%
- 4-(Trifluoromethoxy)phenylisothiocyanate97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Trifluoromethoxy)phenyl Isothiocyanate
CAS:Formula:C8H4F3NOSPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:219.184-(Trifluoromethoxy)phenyl isothiocyanate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H4F3NOSPurity:97%Molecular weight:219.184-(Trifluoromethoxy)phenyl isothiocyanate
CAS:Formula:C8H4F3NOSPurity:98%Color and Shape:LiquidMolecular weight:219.18374-(Trifluoromethoxy)phenyl isothiocyanate
CAS:4-(Trifluoromethoxy)phenyl isothiocyanateFormula:C8H4F3NOSPurity:97%Color and Shape: clear. faint yellow liquidMolecular weight:219.18g/mol4-(Trifluoromethoxy)phenyl isothiocyanate
CAS:Formula:C8H4F3NOSPurity:97%Color and Shape:LiquidMolecular weight:219.184-(Trifluoromethoxy)phenyl Isothiocyanate-13C6
CAS:Controlled ProductFormula:C6C2H4F3NOSColor and Shape:NeatMolecular weight:225.14





