CAS 64287-17-8

1-(2,4-difluorophenyl)butane-1,3-dione

Description:

1-(2,4-Difluorophenyl)butane-1,3-dione, with the CAS number 64287-17-8, is an organic compound characterized by its diketone structure, featuring a butane backbone with two carbonyl (C=O) groups located at the first and third positions. The presence of a 2,4-difluorophenyl group enhances its chemical reactivity and influences its physical properties, such as solubility and boiling point. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can affect its interactions with other molecules. Additionally, the diketone functionality may allow for various chemical transformations, making it a potential candidate for applications in organic synthesis and medicinal chemistry. Its unique structure may also contribute to specific biological activities, although detailed studies would be necessary to elucidate its potential uses in pharmaceuticals or agrochemicals. Overall, 1-(2,4-difluorophenyl)butane-1,3-dione represents a versatile compound with interesting chemical properties.

Formula: C₁₀H₈F₂O₂

InChI: InChI=1/C10H8F2O2/c1-6(13)4-10(14)8-3-2-7(11)5-9(8)12/h2-3,5H,4H2,1H3

SMILES: CC(=O)CC(=O)c1ccc(cc1F)F

Synonyms:

• 64287-17-8
• 1-(2,4-Difluorophenyl)butane-1,3-dione

1-(2,4-Difluorophenyl)butane-1,3-dione

CAS: 64287-17-8

1-(2,4-Difluorophenyl)butane-1,3-dione

Purity: ≥95%

Molecular weight: 198.17g/mol

Ref: 54-PC51674