CAS 64291-41-4: β-D-Glucopyranoside, 4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate
Description:β-D-Glucopyranoside, 4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate, with the CAS number 64291-41-4, is a glycoside compound characterized by its glucopyranoside structure, which consists of a glucose unit linked to a phenolic moiety. This compound features four acetyl groups attached to the hydroxyl groups of the glucose, enhancing its lipophilicity and stability. The presence of the 4-(hydroxymethyl)phenyl group contributes to its aromatic characteristics and potential biological activity. β-D-Glucopyranosides are known for their role in various biochemical processes, including serving as substrates for glycosidases and participating in cell signaling. The acetylation of the hydroxyl groups can influence the solubility and reactivity of the compound, making it useful in synthetic organic chemistry and potentially in pharmaceutical applications. Its structural features suggest that it may exhibit specific interactions with biological targets, which could be explored for therapeutic purposes. Overall, this compound exemplifies the complexity and versatility of glycosides in chemical and biological systems.
Formula:C21H26O11
InChI:InChI=1S/C21H26O11/c1-11(23)27-10-17-18(28-12(2)24)19(29-13(3)25)20(30-14(4)26)21(32-17)31-16-7-5-15(9-22)6-8-16/h5-8,17-22H,9-10H2,1-4H3/t17-,18-,19+,20-,21-/m1/s1
InChI key:InChIKey=HGUDVDQXCUHOED-YMQHIKHWSA-N
SMILES:O=C(OCC1OC(OC2=CC=C(C=C2)CO)C(OC(=O)C)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- Acetagastrodin
- Acetagastrodine
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate
- β-D-Glucopyranoside, 4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate
