CAS 642995-15-1: (1R,2R)-2-(1,3-dioxobenzo[f]isoindol-2-yl)cyclohexanecarboxylic acid
Description:The chemical substance known as (1R,2R)-2-(1,3-dioxobenzo[f]isoindol-2-yl)cyclohexanecarboxylic acid, with the CAS number 642995-15-1, is a complex organic compound characterized by its unique structural features. It contains a cyclohexanecarboxylic acid moiety, which contributes to its acidic properties, and a dioxobenzo[f]isoindole fragment that may impart specific biological activities or interactions. The stereochemistry indicated by the (1R,2R) configuration suggests that the compound has specific spatial arrangements that can influence its reactivity and interactions with biological targets. This compound may exhibit properties such as solubility in organic solvents, potential for forming hydrogen bonds due to the carboxylic acid group, and the ability to participate in various chemical reactions typical of carboxylic acids and aromatic compounds. Its unique structure may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or biologically active compounds. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C19H17NO4
InChI:InChI=1/C19H17NO4/c21-17-14-9-11-5-1-2-6-12(11)10-15(14)18(22)20(17)16-8-4-3-7-13(16)19(23)24/h1-2,5-6,9-10,13,16H,3-4,7-8H2,(H,23,24)/t13-,16-/m1/s1

(1R,2R)-2-(1,3-Dioxo-1H-benzo[f]isoindol-2(3H)-yl)cyclohexanecarboxylic acid
Ref: IN-DA003BGG
10mg | 68.00 € | ||
50mg | 159.00 € |

(1R,2R)-2-(1,3-dioxo-1,3-dihydro-2H-benzo[f]isoindol-2-yl)cyclohexane-1-carboxylic acid
Ref: 10-F724404
10mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(1R,2R)-2-(Naphthalene-2,3-dicarboximido)cyclohexanecarboxylic Acid
Ref: 3D-SAB99515
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |