CAS 643-84-5
:Malvidin
Description:
Malvidin is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in various fruits and vegetables, particularly in grapes and red wine. It is characterized by its chemical structure, which includes a 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-(O-β-D-glucoside) moiety. Malvidin is known for its antioxidant properties, contributing to the health benefits associated with the consumption of fruits and red wine. It is soluble in water and exhibits stability under acidic conditions, making it a valuable compound in food and beverage industries for natural coloring. Additionally, malvidin can undergo various modifications, such as methylation, leading to the formation of derivatives that may exhibit different colors and properties. Its presence is often linked to the sensory attributes of wines, influencing flavor and aroma profiles. Overall, malvidin plays a significant role in both the aesthetic and health-related aspects of food chemistry.
Formula:C17H15O7·Cl
InChI:InChI=1S/C17H14O7.ClH/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17;/h3-7H,1-2H3,(H3-,18,19,20,21);1H
InChI key:InChIKey=KQIKOUUKQBTQBE-UHFFFAOYSA-N
SMILES:OC=1C(C2=CC(OC)=C(O)C(OC)=C2)=[O+]C3=C(C1)C(O)=CC(O)=C3.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride (1:1)
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, chloride (9CI)
- 3,4',5,7-Tetrahydroxy-2',5'-dimethoxy-2-phenylbenzopyrylium chloride
- 3,4',5,7-Tetrahydroxy-3',5'-dimethoxyflavylium chloride
- 3,4′,5,7-Tetrahydroxy-3′,5′-dimethoxy-2-phenylbenzopyrylium chloride
- 3,4′,5,7-Tetrahydroxy-3′,5′-dimethoxyflavylium chloride
- 3,5,7-Trihydroxy-2-(4-Hydroxy-3,5-Dimethoxyphenyl)Chromenium Chloride
- 3,5,7-Trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyryliumchloride
- Enidin
- Flavylium, 3,4',5,7-tetrahydroxy-3',5'-dimethoxy-, chloride
- Flavylium, 3,4′,5,7-tetrahydroxy-3′,5′-dimethoxy-, chloride
- Malvidin
- Malvidin chloride
- Malvidol
- Malvinidin
- Malvinidol chloride
- Nsc 94526
- Oenidin
- Primulidin
- Syringidin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Malvidin chloride
CAS:Malvidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C17H15O7ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:366.75Malvidin chloride
CAS:Oxygen-heterocyclic compoundFormula:C17H15O7ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:366.76Malvidin Chloride
CAS:Applications Malvidin Chloride is a chemical dye for hair.
Formula:C17H15O7·ClColor and Shape:NeatMolecular weight:366.75Malvidin chloride
CAS:Malvidin chloride is an anthocyanin pigment, which is a type of flavonoid. It is predominantly sourced from various plant species, notably in the fruits and skins of berries such as grapes and blueberries, and also in petals of certain flowers. Malvidin chloride is produced as a chloride salt form to increase its stability and solubility for various applications in research.Formula:C17H15ClO7Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:366.75 g/molMalvidin Chloride-d6
CAS:Controlled ProductFormula:C17H9D6O7·ClColor and Shape:NeatMolecular weight:372.78Malvidin chloride
CAS:Malvidin chloride has anti-spermatogenic, and antioxidant activities. It can prevent endothelial dysfunction by inhibiting ROS and XO-1.Formula:C17H15ClO7Purity:98%Color and Shape:LiquidMolecular weight:366.75







