CymitQuimica logo

CAS 643069-40-3

:

8-Bromo-5-methoxy-4(1H)-quinolinone

Description:
8-Bromo-5-methoxy-4(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which features a bromine atom and a methoxy group as substituents. This compound typically exhibits a yellow to orange crystalline appearance. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The presence of the bromine atom can enhance its reactivity and influence its interaction with biological targets. The methoxy group contributes to the compound's lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound's structure allows for various synthetic modifications, enabling the exploration of derivatives with potentially improved pharmacological profiles. As with many quinolinone derivatives, it may also exhibit fluorescence properties, which can be useful in analytical applications. Overall, 8-Bromo-5-methoxy-4(1H)-quinolinone represents a versatile scaffold in drug discovery and development.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c1-14-8-3-2-6(11)10-9(8)7(13)4-5-12-10/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=AJYLXPGUZHOYLF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(Br)C=C1)NC=CC2=O
Synonyms:
  • 8-Bromo-5-methoxy-4(1H)-quinolinone
  • 4(1H)-Quinolinone, 8-bromo-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.