CAS 64309-05-3: 6-(4-azido-2-nitrophenylamino)*hexanoic acid N-
Description:6-(4-Azido-2-nitrophenylamino)hexanoic acid N- is a chemical compound characterized by its unique functional groups, including an azido group and a nitrophenyl moiety, which contribute to its reactivity and potential applications in various fields such as biochemistry and materials science. The presence of the hexanoic acid backbone provides a hydrophobic character, while the azido group can participate in click chemistry reactions, making it useful for bioconjugation and labeling studies. The nitrophenyl group may also impart specific electronic properties, influencing the compound's behavior in different chemical environments. This compound is typically synthesized through multi-step organic reactions, and its stability and solubility can vary depending on the solvent and conditions used. As with many azido compounds, it should be handled with care due to potential explosive properties under certain conditions. Overall, this compound's unique structure and functional groups make it a valuable tool in chemical research and development.
Formula:C16H19N6O6
InChI:InChI=1/C16H18N6O6/c17-20-19-11-5-6-12(13(10-11)22(26)27)18-9-3-1-2-4-16(25)28-21-14(23)7-8-15(21)24/h5-6,10,17H,1-4,7-9H2/p+1
- Synonyms:
- N-Succinimidyl-6-(4'-azido-2'-nitrophenylamino)hexanoate
- 6-Sanh
- 2,5-Pyrrolidinedione, 1-((6-((4-azido-2-nitrophenyl)amino)-1-oxohexyl)oxy)-
- 1-({6-[(4-Azido-2-Nitrophenyl)Amino]Hexanoyl}Oxy)Pyrrolidine-2,5-Dione
- 1-[4-({6-[(2,5-Dioxopyrrolidin-1-Yl)Oxy]-6-Oxohexyl}Amino)-3-Nitrophenyl]Triaza-1,2-Dien-2-Ium
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | SANPAH REF: 3B-A3318CAS: 64309-05-3 | >95.0%(HPLC) | 110.00 €~345.00 € | Tue 22 Apr 25 |
![]() | SANPAH REF: IN-DA00EFSICAS: 64309-05-3 | 95% | 181.00 €~219.00 € | Tue 29 Apr 25 |

SANPAH
Ref: 3B-A3318
25mg | 110.00 € | ||
100mg | 345.00 € |

Ref: IN-DA00EFSI
25mg | 181.00 € | ||
100mg | 219.00 € |