CAS 64310-34-5
:5-(4-methylphenyl)-4H-1,2,4-triazole-3-thiol
Description:
5-(4-Methylphenyl)-4H-1,2,4-triazole-3-thiol, with the CAS number 64310-34-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thiol (-SH) functional group, which imparts unique reactivity and properties, including the ability to form disulfide bonds and participate in redox reactions. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit various biological activities, making it of interest in pharmaceutical and agricultural applications, particularly as a fungicide or herbicide. Its stability, reactivity, and interactions with other chemical species can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as thiol compounds can be sensitive to oxidation and may have specific toxicity profiles. Overall, this compound represents a class of triazole derivatives with diverse applications in chemistry and related fields.
Formula:C9H9N3S
InChI:InChI=1/C9H9N3S/c1-6-2-4-7(5-3-6)8-10-9(13)12-11-8/h2-5H,1H3,(H2,10,11,12,13)
SMILES:Cc1ccc(cc1)c1nc([nH]n1)S
Synonyms:- 1H-1,2,4-triazole-5-thiol, 3-(4-methylphenyl)-
- 3-(4-Methylphenyl)-1H-1,2,4-triazole-5-thiol
- 4H-1,2,4-Triazole-3-thiol, 5-(4-methylphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-(4-Methylphenyl)-4H-1,2,4-triazole-3-thiol
CAS:5-(4-Methylphenyl)-4H-1,2,4-triazole-3-thiol is a crystalline compound that has been shown to form cyclocondensation products with certain amino acids. It also acts as an x-ray diffraction reagent and can be used in the study of the interaction between x-rays and matter. 5-(4-Methylphenyl)-4H-1,2,4-triazole-3-thiol has been shown to react with amino acids such as L -alanine, L -serine, and L -leucine to form new compounds. This reaction is regioselective as it only occurs at the C5 position on the thiazole ring.Formula:C9H9N3SPurity:Min. 95%Molecular weight:191.26 g/mol
