CAS 64321-45-5

Piperidine, 3-[3-(trifluoromethyl)phenyl]-

Description:

Piperidine, 3-[3-(trifluoromethyl)phenyl]- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a trifluoromethyl group attached to a phenyl ring, which contributes to its unique properties. This substitution can enhance the lipophilicity and biological activity of the molecule. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the trifluoromethyl group can also influence the compound's reactivity and stability, often making it more resistant to metabolic degradation. In terms of physical properties, piperidine derivatives generally have moderate boiling points and solubility in organic solvents. Safety data for this compound would indicate potential hazards, including toxicity, and appropriate handling precautions should be taken. As with many piperidine derivatives, it may serve as a building block in the synthesis of more complex organic molecules or pharmaceuticals.

Formula: C₁₂H₁₄F₃N

InChI: InChI=1S/C12H14F3N/c13-12(14,15)11-5-1-3-9(7-11)10-4-2-6-16-8-10/h1,3,5,7,10,16H,2,4,6,8H2

InChI key: InChIKey=NAAXALWMZKHEHY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)C2CCCNC2

Synonyms:

• 3-(3-Trifluoromethylphenyl)piperidine
• Piperidine, 3-[3-(trifluoromethyl)phenyl]-

3-[3-(Trifluoromethyl)phenyl]piperidine

CAS: 64321-45-5

Versatile small molecule scaffold

Formula: C₁₂H₁₄F₃N

Purity: Min. 95%

Molecular weight: 229.24 g/mol

Ref: 3D-PCA32145