CAS 64321-62-6

4-Hydroxy-6-(1-methylethyl)-3-quinolinecarboxylic acid

Description:

4-Hydroxy-6-(1-methylethyl)-3-quinolinecarboxylic acid, with the CAS number 64321-62-6, is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its acidic properties, making it a potential candidate for various chemical reactions and applications. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and reactivity in different solvents. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its unique structure allows for interactions with biological systems, which could be explored in medicinal chemistry. As with many quinoline derivatives, it may also possess fluorescent properties, making it useful in analytical chemistry. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for specific safety guidelines.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1S/C13H13NO3/c1-7(2)8-3-4-11-9(5-8)12(15)10(6-14-11)13(16)17/h3-7H,1-2H3,(H,14,15)(H,16,17)

InChI key: InChIKey=LCBHPWQYKRZFED-UHFFFAOYSA-N

SMILES: OC=1C2=C(N=CC1C(O)=O)C=CC(C(C)C)=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-hydroxy-6-(1-methylethyl)-
• 4-Hydroxy -6-isopropylquinoline- 3-carboxylic acid
• 4-Hydroxy-6-(1-methylethyl)-3-quinolinecarboxylic acid
• 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylic acid

4-Hydroxy-6-isopropylquinoline-3-carboxylic acid

CAS: 64321-62-6

4-Hydroxy-6-isopropylquinoline-3-carboxylic acid

Purity: ≥95%

Molecular weight: 231.25g/mol

Ref: 54-OR183488