CAS 64328-63-8
:4-(hexyloxy)benzohydrazide
Description:
4-(Hexyloxy)benzohydrazide is an organic compound characterized by its hydrazide functional group attached to a benzene ring that is further substituted with a hexyloxy group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic hexyloxy chain. The presence of the hydrazide functional group suggests potential reactivity, particularly in condensation reactions and as a precursor for various derivatives. Its molecular structure indicates that it may exhibit properties such as moderate to high melting points and stability under standard conditions. Additionally, the hexyloxy substituent can influence the compound's lipophilicity, potentially affecting its biological activity and interactions with other molecules. As with many organic compounds, safety precautions should be taken when handling 4-(hexyloxy)benzohydrazide, as it may pose health risks if ingested or inhaled. Overall, this compound may find applications in fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C13H20N2O2
InChI:InChI=1/C13H20N2O2/c1-2-3-4-5-10-17-12-8-6-11(7-9-12)13(16)15-14/h6-9H,2-5,10,14H2,1H3,(H,15,16)
SMILES:CCCCCCOc1ccc(cc1)C(=O)NN
Synonyms:- 4-Hexyloxy-benzoic acid hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(Hexyloxy)benzohydrazide
CAS:4-(Hexyloxy)benzohydrazide is a chloride salt that is used as an antibacterial agent. It has been shown to be active against both Gram-positive and Gram-negative bacteria. 4-(Hexyloxy)benzohydrazide has also been shown to be effective against strains of methicillin-resistant Staphylococcus aureus (MRSA). This compound is prepared by reacting formaldehyde with hexahydrated 4-methoxybenzaldehyde in water, followed by crystallization from water or acetone. The crystals are colorless and have a melting point of 177 °C. 4-(Hexyloxy)benzohydrazide has a low solubility in water, but its solubility increases when it is mixed with other compounds such as acetaldehyde, which may contribute to its antimicrobial activity.Formula:C13H20N2O2Purity:Min. 95%Molecular weight:236.32 g/mol
