CAS 64331-48-2: pLNH
Description:The chemical substance known as pLNH, with the CAS number 64331-48-2, is a compound that falls under the category of organic chemicals. While specific details about its physical and chemical properties may not be widely documented, compounds like pLNH typically exhibit characteristics such as being a liquid or solid at room temperature, depending on their molecular structure. They may possess functional groups that influence their reactivity, solubility, and interactions with other substances. The presence of nitrogen in its name suggests potential applications in fields such as pharmaceuticals or agrochemicals, where nitrogen-containing compounds are often significant. Additionally, the behavior of pLNH in various environments, including its stability, toxicity, and environmental impact, would be essential for understanding its practical applications and safety considerations. For precise information regarding its properties, safety data, and applications, consulting specialized chemical databases or literature would be necessary.
Formula:C40H68N2O31
InChI:InChI=1S/C40H68N2O31/c1-10(50)41-19-26(59)32(18(9-49)68-36(19)72-34-24(57)16(7-47)66-39(29(34)62)69-31(13(53)4-44)21(54)12(52)3-43)70-40-30(63)35(25(58)17(8-48)67-40)73-37-20(42-11(2)51)33(23(56)15(6-46)64-37)71-38-28(61)27(60)22(55)14(5-45)65-38/h3,12-40,44-49,52-63H,4-9H2,1-2H3,(H,41,50)(H,42,51)/t12-,13+,14+,15+,16+,17+,18+,19+,20+,21+,22-,23+,24-,25-,26+,27-,28+,29+,30+,31+,32+,33+,34-,35-,36-,37-,38-,39-,40-/m0/s1
InChI key:InChIKey=JBUKBMAGFHJXMR-VGGBRENTSA-N
SMILES:O=CC(O)C(O)C(OC1OC(CO)C(O)C(OC2OC(CO)C(OC3OC(CO)C(O)C(OC4OC(CO)C(O)C(OC5OC(CO)C(O)C(O)C5O)C4NC(=O)C)C3O)C(O)C2NC(=O)C)C1O)C(O)CO
- Synonyms:
- p-Lacto-N-hexaose
- D-Glucose, O-β-D-galactopyranosyl-(1→3)-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-
- O-β-D-Galactopyranosyl-(1→3)-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose
- pLNH
- Para-lacto-N-hexaose
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | p-Lacto-N-hexaose REF: 7W-GC9741CAS: 64331-48-2 | ≥ 90% | To inquire | Thu 17 Apr 25 |
![]() | p-Lacto-N-hexaose REF: 3D-OL06839CAS: 64331-48-2 | Min. 95% | 797.00 €~5,985.00 € | Tue 29 Apr 25 |

p-Lacto-N-hexaose
Ref: 7W-GC9741
Undefined size | To inquire |

p-Lacto-N-hexaose
Ref: 3D-OL06839
1mg | 797.00 € | ||
2mg | 1,229.00 € | ||
5mg | 1,707.00 € | ||
10mg | 2,793.00 € | ||
25mg | 5,985.00 € |