CAS 64353-30-6

4-(2-Aminoethyl)phenylmethanol

Description:

4-(2-Aminoethyl)phenylmethanol, with the CAS number 64353-30-6, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a phenyl ring. This compound features a phenylmethanol structure, where the hydroxyl (-OH) group is bonded to a benzene ring, and an aminoethyl side chain is attached to the para position of the phenyl group. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl group. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₃NO

InChI: InChI=1/C9H13NO/c10-6-5-8-1-3-9(7-11)4-2-8/h1-4,11H,5-7,10H2

SMILES: c1cc(ccc1CCN)CO

[4-(2-Aminoethyl)phenyl]methanol

CAS: 64353-30-6

Formula: C₉H₁₃NO

Molecular weight: 151.2056

Ref: IN-DA00EC6H

[4-(2-Amino-ethyl)-phenyl]-methanol

CAS: 64353-30-6

Versatile small molecule scaffold

Formula: C₉H₁₃NO

Purity: Min. 95%

Molecular weight: 151.21 g/mol

Ref: 3D-PCA35330