CymitQuimica logo

CAS 64354-26-3

:

4,6-Dibromo-5-hydroxy-2-pyridinecarboxylic acid

Description:
4,6-Dibromo-5-hydroxy-2-pyridinecarboxylic acid, with the CAS number 64354-26-3, is an organic compound characterized by its pyridine ring structure, which is substituted at the 2, 4, 5, and 6 positions. This compound features two bromine atoms and a hydroxyl group, contributing to its unique chemical properties. The presence of the carboxylic acid functional group enhances its acidity and solubility in polar solvents. The bromine substituents can influence the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and agrochemicals. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its physical properties such as melting and boiling points. This compound may exhibit biological activity, making it of interest in pharmacological research. Overall, 4,6-Dibromo-5-hydroxy-2-pyridinecarboxylic acid is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C6H3Br2NO3
InChI:InChI=1S/C6H3Br2NO3/c7-2-1-3(6(11)12)9-5(8)4(2)10/h1,10H,(H,11,12)
InChI key:InChIKey=KAQSHVQNOSITQB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Br)=C(O)C(Br)=N1
Synonyms:
  • 4,6-Dibromo-5-hydroxy-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 4,6-dibromo-5-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.