CAS 64356-57-6
:5-aminopyridine-2-sulfonamide
Description:
5-Aminopyridine-2-sulfonamide, with the CAS number 64356-57-6, is an organic compound that features a pyridine ring substituted with an amino group and a sulfonamide functional group. This compound typically appears as a solid and is characterized by its solubility in polar solvents, which is influenced by the presence of the sulfonamide group. The amino group contributes to its basicity, while the sulfonamide moiety can engage in hydrogen bonding, enhancing its reactivity and potential biological activity. 5-Aminopyridine-2-sulfonamide is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as sulfonamides are known for their antibacterial properties. The compound's structure allows it to interact with various biological targets, making it a subject of research in drug development. Additionally, its stability under standard conditions and the ability to form derivatives through further chemical modifications expand its utility in synthetic chemistry and biological studies.
Formula:C5H7N3O2S
InChI:InChI=1/C5H7N3O2S/c6-4-1-2-5(8-3-4)11(7,9)10/h1-3H,6H2,(H2,7,9,10)
SMILES:c1cc(ncc1N)S(=O)(=O)N
Synonyms:- 2-Pyridinesulfonamide, 5-Amino-
- 5-Aminopyridine-2-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Aminopyridine-2-sulfonamide
CAS:Formula:C5H7N3O2SPurity:95%Color and Shape:SolidMolecular weight:173.19305-Aminopyridine-2-sulfonamide
CAS:<p>5-Aminopyridine-2-sulfonamide (5APS) is an inhibitor of carbonic anhydrase. It binds to the active site of the enzyme, which is a cavity in the protein's surface, and prevents the conversion of CO2 to HCO3-. The inhibition of this process leads to a decrease in the production of bicarbonate ions and an increase in acidity. 5APS has been shown to have inhibitory properties against several isoforms of carbonic anhydrase, including those found in bacteria and erythrocytes. X-ray crystallographic studies have led to the rationalization of its binding mode within the active site. 5APS has been shown to be effective as a treatment for glaucoma by reducing intraocular pressure.</p>Formula:C5H7N3O2SPurity:Min. 95%Molecular weight:173.19 g/mol

