CAS 64364-50-7

O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-β-D-galactopyranosyl-(1→4)-2-(acetylamino)-2-deoxy-β-D-glucopyranose

Description:

The chemical substance known as O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-β-D-galactopyranosyl-(1→4)-2-(acetylamino)-2-deoxy-β-D-glucopyranose, with the CAS number 64364-50-7, is a complex glycosylated compound that features multiple sugar moieties linked through specific glycosidic bonds. This structure includes N-acetylneuraminic acid, which is a sialic acid derivative, contributing to its biological significance, particularly in cell recognition and signaling processes. The presence of β-D-galactopyranosyl and β-D-glucopyranose units indicates its role in carbohydrate metabolism and potential interactions with lectins or other carbohydrate-binding proteins. The acetylamino groups suggest that the compound may exhibit solubility in polar solvents and could participate in various biochemical pathways. Its intricate structure may also imply potential applications in biomedicine, particularly in the development of therapeutics or as a component in vaccine formulations. Overall, this compound exemplifies the complexity and diversity of glycosylated molecules in biological systems.

Formula: C₂₅H₄₂N₂O₁₉

InChI: InChI=1S/C25H42N2O19/c1-7(30)26-13-9(32)3-25(24(40)41,46-21(13)15(34)10(33)4-28)42-6-12-16(35)18(37)19(38)23(44-12)45-20-11(5-29)43-22(39)14(17(20)36)27-8(2)31/h9-23,28-29,32-39H,3-6H2,1-2H3,(H,26,30)(H,27,31)(H,40,41)/t9-,10+,11+,12+,13+,14+,15+,16-,17+,18-,19+,20+,21+,22+,23-,25+/m0/s1

InChI key: InChIKey=RPSBVJXBTXEJJG-LURNZOHQSA-N

SMILES: O(C[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O)[C@H](NC(C)=O)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O)[C@@]3(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(C)=O)[C@@H](O)C3)[H]

Synonyms:

• 6′SLN
• O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-β-D-galactopyranosyl-(1→4)-2-(acetylamino)-2-deoxy-β-D-glucopyranose
• β-D-Glucopyranose, O-(N-acetyl-α-neuraminosyl)-(2→6)-O-β-D-galactopyranosyl-(1→4)-2-(acetylamino)-2-deoxy-

6′SLN

CAS: 64364-50-7

6′SLN is a characteristic glycan found on the surface of cancer-related extracellular vesicles (EVs) and serves as the primary form of protein glycosylation within EVs. Additionally, 6′SLN, a derivative of sialic acid, interacts with hemagglutinins (HAs) from both human and avian influenza strains, making it relevant in the study of anti-influenza drugs.

Formula: C₂₅H₄₂N₂O₁₉

Color and Shape: Solid

Molecular weight: 674.6

Ref: TM-T200406