CAS 643723-43-7

4-(4-Fluorophenyl)-2-thiazolemethanamine

Description:

4-(4-Fluorophenyl)-2-thiazolemethanamine, identified by its CAS number 643723-43-7, is a chemical compound characterized by its thiazole ring and an amine functional group. This compound features a fluorophenyl substituent, which can influence its electronic properties and reactivity. Thiazoles are known for their diverse biological activities, and the presence of the amine group may enhance its potential as a pharmacophore in medicinal chemistry. The fluorine atom can also affect the lipophilicity and metabolic stability of the compound, making it of interest in drug design. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, which could be explored in various applications, including pharmaceuticals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, the unique structure of 4-(4-Fluorophenyl)-2-thiazolemethanamine suggests potential utility in research and development within the fields of medicinal chemistry and material science.

Formula: C₁₀H₉FN₂S

InChI: InChI=1S/C10H9FN2S/c11-8-3-1-7(2-4-8)9-6-14-10(5-12)13-9/h1-4,6H,5,12H2

InChI key: InChIKey=DVIOACKZHUPVGY-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=CS1)C2=CC=C(F)C=C2

Synonyms:

• 4-(4-Fluorophenyl)-2-thiazolemethanamine
• 2-Thiazolemethanamine, 4-(4-fluorophenyl)-
• [[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]methyl]amine
• [4-(4-Fluorophenyl)-1,3-thiazol-2-yl]methanamine
• 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methanamine(SALTDATA: FREE)

1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methanamine

CAS: 643723-43-7

Formula: C₁₀H₉FN₂S

Purity: 95.0%

Molecular weight: 208.25

Ref: 10-F308363