CymitQuimica logo

CAS 64375-68-4

:

4-(4-chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one

Description:
4-(4-chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one, with the CAS number 64375-68-4, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a butan-2-one moiety, indicating the presence of a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chloro group and a methoxy group on the quinoline ring enhances its chemical properties, potentially influencing its biological activity and solubility. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the quinoline ring, making it a subject of study for various applications in drug development and chemical research.
Formula:C15H16ClNO2
InChI:InChI=1/C15H16ClNO2/c1-9(18)4-6-12-10(2)17-14-7-5-11(19-3)8-13(14)15(12)16/h5,7-8H,4,6H2,1-3H3
SMILES:CC(=O)CCc1c(C)nc2ccc(cc2c1Cl)OC
Synonyms:
  • 4-(4-Chloro-6-methoxy-2-methyl-quinolin-3-yl)-butan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.