CAS 643764-88-9
:5-[[4-[2-(2-Pyridinylamino)ethoxy]phenyl]methylene]-2,4-thiazolidinedione
Description:
5-[[4-[2-(2-Pyridinylamino)ethoxy]phenyl]methylene]-2,4-thiazolidinedione, identified by its CAS number 643764-88-9, is a synthetic organic compound that belongs to the class of thiazolidinediones, which are known for their role in pharmacology, particularly in the treatment of diabetes. This compound features a thiazolidinedione core, characterized by a five-membered ring containing sulfur and nitrogen, which is linked to a phenyl group substituted with a pyridinylamino moiety. The presence of the pyridine ring suggests potential interactions with biological targets, enhancing its pharmacological profile. The compound's structure indicates it may exhibit properties such as anti-inflammatory and insulin-sensitizing effects, making it of interest in metabolic disease research. Additionally, the ethoxy group contributes to its solubility and bioavailability. Overall, this compound's unique structural features and potential biological activities make it a subject of interest in medicinal chemistry and drug development.
Formula:C17H15N3O3S
InChI:InChI=1S/C17H15N3O3S/c21-16-14(24-17(22)20-16)11-12-4-6-13(7-5-12)23-10-9-19-15-3-1-2-8-18-15/h1-8,11H,9-10H2,(H,18,19)(H,20,21,22)
InChI key:InChIKey=GFMJDJHGHVLTLE-UHFFFAOYSA-N
SMILES:C(=C1C(=O)NC(=O)S1)C2=CC=C(OCCNC3=CC=CC=N3)C=C2
Synonyms:- 2,4-Thiazolidinedione, 5-[[4-[2-(2-pyridinylamino)ethoxy]phenyl]methylene]-
- 5-[[4-[2-(2-Pyridinylamino)ethoxy]phenyl]methylene]-2,4-thiazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(5-[4-N-(2-Pyridylamino)ethoxy]benzylidene] thiazolidine-2,4-dione)
CAS:Formula:C17H15N3O3SMolecular weight:341.39

