CAS 64379-96-0
:(2E)-3-(3-fluorophenyl)prop-2-enamide
Description:
(2E)-3-(3-fluorophenyl)prop-2-enamide, with the CAS number 64379-96-0, is an organic compound characterized by its amide functional group and a conjugated double bond system. This compound features a prop-2-enamide backbone, which includes a trans configuration (denoted by 2E) around the double bond, contributing to its geometric isomerism. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the aromatic ring, which can influence the compound's electronic properties and reactivity. The fluorine atom often enhances lipophilicity and can affect the compound's biological activity. This substance may exhibit various physical properties such as solubility in organic solvents and potential reactivity in chemical reactions typical of amides, including hydrolysis and acylation. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the phenyl ring can lead to variations in biological activity.
Formula:C9H8FNO
InChI:InChI=1/C9H8FNO/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H2,11,12)/b5-4+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
