CAS 64395-92-2: β-D-Glucopyranose, 1-dodecanoate
Description:β-D-Glucopyranose, 1-dodecanoate is a glycoside derived from β-D-glucopyranose, a six-membered cyclic form of glucose, and dodecanoic acid, also known as lauric acid. This compound features a long hydrophobic dodecanoyl chain, which contributes to its amphiphilic nature, making it soluble in both polar and non-polar solvents. The presence of the glucopyranose moiety imparts sweetness and potential biological activity, while the dodecanoate group enhances its surfactant properties. This substance is often studied for its applications in food science, pharmaceuticals, and as a potential emulsifier or stabilizer in various formulations. Its molecular structure allows for interactions with biological membranes, which may influence its bioavailability and efficacy in drug delivery systems. Additionally, β-D-glucopyranose derivatives are of interest in the development of glycosylated compounds for therapeutic uses, given their ability to modulate biological processes. Overall, β-D-glucopyranose, 1-dodecanoate exemplifies the intersection of carbohydrate chemistry and fatty acid derivatives, showcasing unique properties that can be harnessed in multiple fields.
Formula:C18H34O7
InChI:InChI=1S/C18H34O7/c1-2-3-4-5-6-7-8-9-10-11-14(20)25-18-17(23)16(22)15(21)13(12-19)24-18/h13,15-19,21-23H,2-12H2,1H3/t13-,15-,16+,17-,18+/m1/s1
InChI key:InChIKey=HABWUWJGNVZVPU-LHKMKVQPSA-N
SMILES:O=C(OC1OC(CO)C(O)C(O)C1O)CCCCCCCCCCC
- Synonyms:
- 1-Oxo-Dodecyl-Ss-D-Glucopyranoside
- 1-Oxododecyl-Beta-D-Glucopyranoside, 99+%
- 1-Oxododecylb-D-glucopyranoside
- β-<span class="text-smallcaps">D</span>-Glucopyranose, 1-dodecanoate
- β-D-Glucopyranose, 1-dodecanoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Oxododecyl b-D-glucopyranoside REF: 7W-GC7282CAS: 64395-92-2 | - - - | To inquire | Mon 21 Apr 25 |
![]() | 1-Oxododecyl β-D-glucopyranoside REF: 3D-DO00320CAS: 64395-92-2 | Min. 95 Area-% | 143.00 €~334.00 € | Thu 12 Jun 25 |

1-Oxododecyl β-D-glucopyranoside
Ref: 3D-DO00320
5g | 334.00 € |