CAS 64396-09-4
:Phenol, 4,4′-[1-methyl-2-(2,2,2-trifluoroethyl)-1,2-ethanediyl]bis-, [R-(R*,S*)]-
Description:
Phenol, 4,4′-[1-methyl-2-(2,2,2-trifluoroethyl)-1,2-ethanediyl]bis-, also known by its CAS number 64396-09-4, is an organic compound characterized by its phenolic structure, which includes two phenol groups connected by a specific ethylene bridge. This compound features a trifluoroethyl substituent, which imparts unique properties such as increased hydrophobicity and potential applications in various chemical processes. The presence of the methyl group and the trifluoroethyl group can influence its reactivity and solubility in different solvents. Typically, phenolic compounds exhibit antioxidant properties and can participate in hydrogen bonding due to the hydroxyl (-OH) groups. This compound may be utilized in the synthesis of polymers, pharmaceuticals, or as an intermediate in organic synthesis. Safety considerations are important, as many phenolic compounds can be toxic or irritative, necessitating proper handling and disposal protocols. Overall, this compound's unique structure and substituents contribute to its potential utility in various chemical applications.
Formula:C17H17F3O2
InChI:InChI=1/C17H17F3O2/c1-11(12-2-6-14(21)7-3-12)16(10-17(18,19)20)13-4-8-15(22)9-5-13/h2-9,11,16,21-22H,10H2,1H3/t11-,16-/m0/s1
InChI key:InChIKey=KTUJPJJUMKZGCV-ZBEGNZNMSA-N
SMILES:[C@@H]([C@@H](C)C1=CC=C(O)C=C1)(CC(F)(F)F)C2=CC=C(O)C=C2
Synonyms:- Terfluranol
- 4,4'-((1R,2S)-1-Methyl-2-(2,2,2-trifluoroethyl)ethylene)diphenol
- Phenol, 4,4′-[1-methyl-2-(2,2,2-trifluoroethyl)-1,2-ethanediyl]bis-, [R-(R*,S*)]-
- 4,4'-[(2R,3S)-5,5,5-trifluoropentane-2,3-diyl]diphenol
- Terfluranol [INN:BAN]
- UNII-WUF1DL156G
- Phenol, 4,4'-[1-methyl-2-(2,2,2-trifluoroethyl)-1,2-ethanediyl]bis-, [R-(R*,S*)]- (9CI)
- 4,4'-[(1R,2S)-1-Methyl-2-(2,2,2-trifluoroethyl)ethylene]bisphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Terfluranol
CAS:Terfluranol, a benzyl derivative, is utilized as an antitumor medication.Formula:C17H17F3O2Color and Shape:SolidMolecular weight:310.31
