CAS 644-30-4: Curcumene
Description:Curcumene, with the CAS number 644-30-4, is a naturally occurring sesquiterpene found in various essential oils, particularly in turmeric and ginger. It is characterized by its distinct aromatic properties, contributing to the fragrance profile of the plants from which it is derived. Curcumene is a colorless to pale yellow liquid at room temperature and is known for its relatively low volatility. The compound exhibits a complex structure, featuring multiple double bonds, which contributes to its reactivity and potential biological activity. Curcumene has garnered interest in the fields of pharmacology and food science due to its potential antioxidant, anti-inflammatory, and antimicrobial properties. Additionally, it is studied for its role in traditional medicine and as a flavoring agent in culinary applications. Its solubility in organic solvents and limited solubility in water are notable characteristics, influencing its applications in various formulations. Overall, curcumene represents a significant compound in both natural product chemistry and potential therapeutic uses.
Formula:C15H22
InChI:InChI=1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3
InChI key:InChIKey=VMYXUZSZMNBRCN-UHFFFAOYSA-N
SMILES:C=1C=C(C=CC1C)C(C)CCC=C(C)C
- Synonyms:
- (±)-a-Curcumene
- 1-(1,5-Dimethyl-4-hexen-1-yl)-4-methylbenzene
- 1-(1,5-Dimethyl-4-hexenyl)-4-methylbenzene
- 2-Heptene, 2-methyl-6-p-tolyl-
- 2-Methyl-6-p-tolyl-2-heptene
- 644-30-4
- Benzene, 1-(1,5-dimethyl-4-hexen-1-yl)-4-methyl-
- Benzene, 1-(1,5-dimethyl-4-hexenyl)-4-methyl-
- Curcumene
- ar-Curcumene
- See more synonyms
- 1-Methyl-4-(6-methylhept-5-en-2-yl)benzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | α-Curcumene REF: 11-5225SCAS: 644-30-4 | (GC) ≥90% | 259.00 € | Thu 24 Apr 25 |
![]() | α-Curcumene REF: BP-BP2287CAS: 644-30-4 | 95%~99% | 166.00 €~1,016.00 € | Fri 02 May 25 |
![]() | aR-Curcumene REF: 3D-AAA64430CAS: 644-30-4 | Min. 95% | - - - | Discontinued product |

α-Curcumene
Ref: 11-5225S
100mg | 259.00 € |

Ref: BP-BP2287
10mg | 166.00 € | ||
20mg | 248.00 € | ||
100mg | 1,016.00 € |

aR-Curcumene
Ref: 3D-AAA64430
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |