CAS 644-48-4
:3,6-dideoxy-D-xylo-hexose
Description:
3,6-Dideoxy-D-xylo-hexose is a monosaccharide, specifically a hexose sugar, characterized by the absence of hydroxyl groups at the 3rd and 6th carbon positions. This compound belongs to the category of deoxy sugars, which are sugars that have one or more hydroxyl groups replaced by hydrogen atoms. Its structure features a six-carbon backbone with a specific stereochemistry that defines its D-configuration and xylo-configuration. The presence of these configurations influences its reactivity and interactions with other biomolecules. 3,6-Dideoxy-D-xylo-hexose is often involved in various biochemical processes and can serve as a building block for more complex carbohydrates. It is also relevant in the study of glycosylation and the synthesis of glycosides. The compound is typically found in certain natural products and may have implications in medicinal chemistry and biochemistry, particularly in the context of antibiotic development and the study of bacterial polysaccharides.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m1/s1
SMILES:C[C@H]([C@@H](C[C@H](C=O)O)O)O
Synonyms:- 644-48-4
- 3,6-Dideoxy-D-xylo-hexose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
