CAS 644-62-2

Meclofenamic acid

Description:

Meclofenamic acid is a non-steroidal anti-inflammatory drug (NSAID) primarily used for its analgesic and anti-inflammatory properties. It belongs to the fenamate class of NSAIDs and is characterized by its ability to inhibit cyclooxygenase enzymes, which play a crucial role in the synthesis of prostaglandins involved in inflammation and pain. The chemical formula of meclofenamic acid is C15H14ClN and it features a chlorobenzene ring, a phenyl group, and a carboxylic acid functional group, contributing to its pharmacological activity. It is typically administered in oral form and is indicated for the treatment of conditions such as arthritis and dysmenorrhea. Meclofenamic acid is known for its potential side effects, which may include gastrointestinal disturbances, cardiovascular risks, and renal impairment, necessitating careful monitoring during use. Additionally, it is important to consider contraindications and interactions with other medications. Overall, meclofenamic acid is a potent anti-inflammatory agent with a specific chemical structure that underpins its therapeutic effects.

Formula:C₁₄H₁₁Cl₂NO₂

InChI:InChI=1/C14H11Cl2NO2.Na/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19;/h2-7,17H,1H3,(H,18,19);/q;+1/p-1

InChI key:InChIKey=SBDNJUWAMKYJOX-UHFFFAOYSA-N

SMILES:N(C1=C(Cl)C(C)=CC=C1Cl)C2=C(C(O)=O)C=CC=C2

Synonyms: