CAS 6440-02-4

Ethyl 5-amino-1,2,3-thiadiazole-4-carboxylate

Description:

Ethyl 5-amino-1,2,3-thiadiazole-4-carboxylate is a heterocyclic organic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The amino group attached to the thiadiazole ring enhances its reactivity, making it a potential candidate for various chemical reactions, including coupling reactions in organic synthesis. The carboxylate group indicates that it can participate in acid-base reactions, acting as a weak acid. Ethyl 5-amino-1,2,3-thiadiazole-4-carboxylate is of interest in medicinal chemistry and agricultural applications, particularly as a building block for the synthesis of bioactive compounds. Its unique structure allows for diverse modifications, which can lead to the development of new pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₅H₇N₃O₂S

InChI: InChI=1/C5H7N3O2S/c1-2-10-5(9)3-4(6)11-8-7-3/h2,6H2,1H3

SMILES: CCOC(=O)c1c(N)snn1

Synonyms:

• 1,2,3-Thiadiazole-4-carboxylic acid, 5-amino-, ethyl ester

Ethyl 5-amino-1,2,3-thiadiazole-4-carboxylate

CAS: 6440-02-4

Formula: C₅H₇N₃O₂S

Color and Shape: Solid

Molecular weight: 173.1930

Ref: IN-DA003MCF

Ethyl 5-amino-1,2,3-thiadiazole-4-carboxylate

CAS: 6440-02-4

Purity: 98%

Molecular weight: 173.1900024

Ref: 10-F622091