CAS 6441-73-2
:Acridinium, 3,6-diamino-2,7,10-trimethyl-, chloride (1:1)
Description:
Acridinium, 3,6-diamino-2,7,10-trimethyl-, chloride (1:1), with the CAS number 6441-73-2, is a chemical compound that belongs to the acridine family, characterized by its polycyclic aromatic structure. This compound features multiple amino groups, which contribute to its reactivity and potential applications in various fields, including biochemistry and analytical chemistry. The presence of trimethyl groups enhances its solubility and stability in certain solvents. As a chloride salt, it typically exists in a crystalline form and is soluble in polar solvents. Acridinium derivatives are often utilized in luminescent assays and as labels in chemiluminescent detection systems due to their ability to emit light upon oxidation. The compound's unique structure allows for interactions with biological molecules, making it of interest in drug development and molecular biology. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, this compound exemplifies the diverse applications of acridine derivatives in scientific research.
Formula:C16H18N3·Cl
InChI:InChI=1S/C16H17N3.ClH/c1-9-4-11-6-12-5-10(2)14(18)8-16(12)19(3)15(11)7-13(9)17;/h4-8H,1-3H3,(H3,17,18);1H
InChI key:InChIKey=ADAOOVVYDLASGJ-UHFFFAOYSA-N
SMILES:C[N+]=1C2=C(C=C3C1C=C(N)C(C)=C3)C=C(C)C(N)=C2.[Cl-]
Synonyms:- 2,7,10-Trimethyl-3,10-Dihydroacridine-3,6-Diamine
- 3,6-Diamino-2,7,10-Trimethylacridinium
- Acridinium, 3,6-diamino-2,7,10-trimethyl-, chloride
- Acridinium, 3,6-diamino-2,7,10-trimethyl-, chloride (1:1)
- Aurophosphine 4G
- Aurophosphine G
- Basic Yellow 5
- Corioflavin GG
- Corioflavine G
- Corioflavine GGR
- Corioflavine R
- Flavophosphine R
- Phosphine GN
- 3,6-Diamino-2,7,10-trimethylacridinium chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
C.I.Basic Yellow 5
CAS:Basic Yellow 5 is a dye that belongs to the group of organic pigments. It is used in textile and leather production, as well as in food coloring. Basic Yellow 5 has been shown to bind to lectins on the surface of bacteria, which is how it exerts its antibacterial effects. This dye inhibits protein synthesis by binding to the ribosome and preventing amino acid incorporation into proteins. Basic Yellow 5 also inhibits bacterial growth by binding to the ribosome, interfering with protein synthesis and cell division.END>Purity:Min. 95%
