CAS 64421-27-8
:methyl (1S,4aS,7S,7aS)-1-(beta-D-glucopyranosyloxy)-7-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Description:
The chemical substance known as methyl (1S,4aS,7S,7aS)-1-(beta-D-glucopyranosyloxy)-7-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate, with the CAS number 64421-27-8, is a complex organic compound characterized by its unique bicyclic structure and the presence of multiple functional groups. This compound features a glucopyranosyl moiety, indicating it is a glycoside, which contributes to its solubility and potential biological activity. The presence of hydroxyl groups suggests it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. The methyl ester functional group indicates that it can undergo hydrolysis to release the corresponding carboxylic acid. Its stereochemistry, denoted by the specific configuration at several chiral centers, is crucial for its biological activity and interaction with enzymes or receptors. Overall, this compound may have applications in medicinal chemistry or as a natural product derivative, although specific biological activities would require further investigation.
Formula:C17H26O10
InChI:InChI=1/C17H26O10/c1-17(23)4-3-7-8(14(22)24-2)6-25-15(10(7)17)27-16-13(21)12(20)11(19)9(5-18)26-16/h6-7,9-13,15-16,18-21,23H,3-5H2,1-2H3/t7-,9-,10-,11-,12+,13-,15+,16+,17+/m1/s1
Synonyms:- Mussaenoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mussaenoside
CAS:Mussaenoside has anti-inflammatory action, the mechanism associated with downregulation of nuclear factor-κB.Formula:C17H26O10Purity:98%Color and Shape:SolidMolecular weight:390.385Mussaenoside
CAS:<p>Mussaenoside is a naturally occurring iridoid glycoside, which is an active compound derived from various plant species, particularly within the Rubiaceae family. Its source lies primarily in the plant Mussaenda, where it functions as a secondary metabolite. Mussaenoside's mode of action involves modulating inflammatory pathways, including significant inhibition of pro-inflammatory mediators such as cytokines, as well as the regulation of oxidative stress. This biochemical activity is attributed to its ability to interfere with signaling molecules like NF-κB and MAPK pathways.</p>Formula:C17H26O10Purity:Min. 95%Molecular weight:390.4 g/mol


