CAS 64421-69-8
:parathyroid hormone fragment human*44-68
Description:
Parathyroid hormone fragment human 44-68, identified by the CAS number 64421-69-8, is a peptide derived from the parathyroid hormone (PTH), which plays a crucial role in calcium homeostasis and bone metabolism. This specific fragment consists of amino acids 44 to 68 of the full-length human parathyroid hormone, retaining some of the biological activity associated with the full hormone. It is typically characterized by its role in stimulating osteoclast activity, promoting renal tubular reabsorption of calcium, and influencing vitamin D metabolism. The fragment is often studied for its potential therapeutic applications in conditions such as osteoporosis and hypoparathyroidism. In terms of physical properties, it is a water-soluble peptide, and its stability can be influenced by factors such as pH and temperature. The fragment's biological activity is primarily mediated through interactions with specific receptors, leading to downstream signaling pathways that regulate calcium and phosphate levels in the body. Overall, parathyroid hormone fragment 44-68 serves as an important tool in both research and potential clinical applications related to bone health and mineral metabolism.
Formula:C111H189N38O37
InChI:InChI=1/C111H189N38O37/c1-54(2)42-60(49-150)130-102(180)76(51-152)145-93(171)64(23-12-15-37-114)134-94(172)67(28-32-81(156)157)136-99(177)72(44-59-47-123-53-128-59)142-104(182)77(52-153)146-97(175)69(30-34-83(160)161)139-106(184)86(56(5)6)147-100(178)71(43-55(3)4)144-107(185)87(57(7)8)148-101(179)74(46-85(164)165)143-96(174)68(29-33-82(158)159)135-91(169)63(22-11-14-36-113)132-90(168)62(21-10-13-35-112)133-92(170)65(24-17-39-125-110(119)120)138-105(183)78-26-19-41-149(78)108(186)70(25-18-40-126-111(121)122)140-95(173)66(27-31-79(116)154)137-103(181)75(50-151)131-80(155)48-127-88(166)58(9)129-98(176)73(45-84(162)163)141-89(167)61(115)20-16-38-124-109(117)118/h47,53-58,60-78,86-87,151-153H,10-46,48,50-52,112-115H2,1-9H3,(H2,116,154)(H,123,128)(H,127,166)(H,129,176)(H,130,180)(H,131,155)(H,132,168)(H,133,170)(H,134,172)(H,135,169)(H,136,177)(H,137,181)(H,138,183)(H,139,184)(H,140,173)(H,141,167)(H,142,182)(H,143,174)(H,144,185)(H,145,171)(H,146,175)(H,147,178)(H,148,179)(H,156,157)(H,158,159)(H,160,161)(H,162,163)(H,164,165)(H4,117,118,124)(H4,119,120,125)(H4,121,122,126)/t58-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,86-,87-/m0/s1
SMILES:CC(C)C[C@@H](C=O)N=C([C@H](CO)N=C([C@H](CCCCN)N=C([C@H](CCC(=O)O)N=C([C@H](Cc1cnc[nH]1)N=C([C@H](CO)N=C([C@H](CCC(=O)O)N=C([C@H](C(C)C)N=C([C@H](CC(C)C)N=C([C@H](C(C)C)N=C([C@H](CC(=O)O)N=C([C@H](CCC(=O)O)N=C([C@H](CCCCN)N=C([C@H](CCCCN)N=C([C@H](CCCNC(=N)N)N=C([C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)N=C([C@H](CCC(=N)O)N=C([C@H](CO)N=C(CN=C([C@H](C)N=C([C@H](CC(=O)O)N=C([C@H](CCCNC(=N)N)N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O
Synonyms:- Parathyroid hormone (44-68)
- Hpth (44-68)
- Glycine, L-arginyl-L-alpha-aspartyl-L-alanylglycyl-L-seryl-L-glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-lysyl-L-lysyl-L-alpha-glutamyl-L-alpha-aspartyl-L-asparaginyl-L-valyl-L-leucyl-L-valyl-L-alpha-glutamyl-L-seryl-L-histidyl-L-alpha-glutamyl-L-lysyl-L-seryl-L-leucyl-
- pTH (44-68) (human)
- H-Arg-Asp-Ala-Gly-Ser-Gln-Arg-Pro-Arg-Lys-Lys-Glu-Asp-Asn-Val-Leu-Val-Glu-Ser-His-Glu-Lys-Ser-Leu-Gly-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
pTH (44-68) (human)
CAS:Bachem ID: 4026306.
Formula:C117H199N41O41Purity:100.0%Color and Shape:White PowderMolecular weight:2836.12pTH (44-68) (human)
CAS:Please enquire for more information about pTH (44-68) (human) including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C117H199N41O41Purity:Min. 95%Molecular weight:2,836.08 g/mol

