CymitQuimica logo

CAS 6443-50-1

:

Xylamidine

Description:
Xylamidine, with the CAS number 6443-50-1, is a chemical compound that belongs to the class of amidines. It is characterized by the presence of an amidine functional group, which consists of a carbon atom double-bonded to a nitrogen atom and single-bonded to another nitrogen atom. This structure imparts unique properties, such as the ability to act as a weak base and participate in various chemical reactions, including nucleophilic attacks. Xylamidine is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its applications can be found in fields such as pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Xylamidine is a notable compound within its class, with potential utility in various chemical applications.
Formula:C19H24N2O2
InChI:InChI=1S/C19H24N2O2/c1-14-6-4-7-16(10-14)11-19(20)21-13-15(2)23-18-9-5-8-17(12-18)22-3/h4-10,12,15H,11,13H2,1-3H3,(H2,20,21)
InChI key:InChIKey=JRYTUFKIORWTNI-UHFFFAOYSA-N
SMILES:O(C(CNC(CC1=CC(C)=CC=C1)=N)C)C2=CC(OC)=CC=C2
Synonyms:
  • N-[2-(3-Methoxyphenoxy)propyl]-3-methylbenzeneethanimidamide
  • Xylamidine
  • Xylamidine (5-hydroxytryptamine antagonist)
  • Acetamidine, N-[2-(m-methoxyphenoxy)propyl]-2-m-tolyl-
  • Benzeneethanimidamide, N-[2-(3-methoxyphenoxy)propyl]-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.