CAS 64432-04-8

3-Methoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]phenol

Description:

3-Methoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]phenol, with the CAS number 64432-04-8, is an organic compound characterized by its complex structure, which includes a phenolic group and a long hydrocarbon chain. This compound features a methoxy group and a methyl group on the aromatic ring, contributing to its chemical reactivity and potential biological activity. The presence of the dodecatrienyl side chain suggests that it may exhibit properties typical of terpenoids, which are known for their diverse roles in nature, including fragrance and flavor. The compound's structure indicates it may have applications in the fragrance industry or as a potential bioactive agent. Its solubility characteristics would likely depend on the balance between the hydrophilic phenolic part and the hydrophobic hydrocarbon chain. As with many organic compounds, its stability, reactivity, and potential applications would be influenced by environmental factors such as temperature and pH. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₃H₃₄O₂

InChI: InChI=1S/C23H34O2/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-14-21-22(24)15-20(5)16-23(21)25-6/h9,11,13,15-16,24H,7-8,10,12,14H2,1-6H3/b18-11+,19-13+

InChI key: InChIKey=OJJOUHFECGXRFJ-NWLVNBMCSA-N

SMILES: C(/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)C1=C(OC)C=C(C)C=C1O

Synonyms:

• 3-Methoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]phenol
• E,E-5-Methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-1-hydroxy-3-methoxybenzene
• Phenol, 3-methoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-
• Phenol, 3-methoxy-5-methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
• Grifolin monomethyl ether

Grifolin monomethyl ether

CAS: 64432-04-8

Grifolin monomethyl ether is a natural product for research related to life sciences. The catalog number is TN4169 and the CAS number is 64432-04-8.

Formula: C₂₃H₃₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 342.51

Ref: TM-TN4169

Grifolin monomethyl ether

CAS: 64432-04-8

Grifolin monomethyl ether is a naturally occurring bioactive compound, which is derived from fungal sources, particularly from the genera Albatrellus and Polyporus. Its mode of action primarily involves the modulation of cellular pathways, including anti-cancer and anti-inflammatory mechanisms. It interferes with signaling pathways that regulate cell proliferation and apoptosis, showcasing potential in therapeutic applications.

Formula: C₂₃H₃₄O₂

Purity: Min. 95%

Molecular weight: 342.5 g/mol

Ref: 3D-PCA43204