CAS 64432-06-0: Dulcoside A
Description:Dulcoside A, with the CAS number 64432-06-0, is a natural glycoside derived from the plant species Stevia rebaudiana, commonly known for its sweetening properties. It is part of a group of compounds known as steviol glycosides, which are characterized by their intense sweetness, often exceeding that of sucrose. Dulcoside A is typically used as a non-caloric sweetener in various food and beverage applications, appealing to those seeking sugar alternatives. The compound is known for its stability under heat and acidic conditions, making it suitable for cooking and processing. In addition to its sweetening capabilities, Dulcoside A may possess potential health benefits, including antioxidant properties. Its safety has been evaluated, and it is generally recognized as safe (GRAS) by food safety authorities when consumed within established limits. As a natural product, Dulcoside A contributes to the growing trend of using plant-derived ingredients in food formulations, aligning with consumer preferences for healthier and more natural options.
Formula:C38H60O17
InChI:InChI=1S/C38H60O17/c1-16-12-37-10-6-20-35(3,8-5-9-36(20,4)34(49)54-32-29(48)26(45)23(42)18(13-39)51-32)21(37)7-11-38(16,15-37)55-33-30(27(46)24(43)19(14-40)52-33)53-31-28(47)25(44)22(41)17(2)50-31/h17-33,39-48H,1,5-15H2,2-4H3/t17-,18+,19+,20-,21-,22-,23+,24+,25+,26-,27-,28+,29+,30+,31-,32-,33-,35+,36+,37+,38-/m0/s1
InChI key:InChIKey=CANAPGLEBDTCAF-NTIPNFSCSA-N
SMILES:O=C(OC1OC(CO)C(O)C(O)C1O)C2(C)CCCC3(C)C2CCC45CC(=C)C(OC6OC(CO)C(O)C(O)C6OC7OC(C)C(O)C(O)C7O)(CCC43)C5
- Synonyms:
- Dulcoside A
- DulcosideA
- Kaur-16-en-18-oic acid, 13-[[2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</smallcap>-glucopyranosyl]oxy]-, β-<smallcap>D</span>-glucopyranosyl ester, (4α)-
- Kaur-16-en-18-oic acid, 13-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-, β-D-glucopyranosyl ester, (4α)-
