CymitQuimica logo

CAS 64463-46-3

:

methyl 4-formylpyridine-2-carboxylate

Description:
Methyl 4-formylpyridine-2-carboxylate, with the CAS number 64463-46-3, is an organic compound characterized by its pyridine ring structure, which is substituted with both a formyl group and a carboxylate group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of its functional groups. The presence of the formyl group allows for further derivatization, while the carboxylate moiety can participate in various chemical reactions, such as esterification and amidation. Methyl 4-formylpyridine-2-carboxylate may exhibit polar characteristics, making it soluble in polar solvents, and it may also show some degree of reactivity towards nucleophiles. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, this compound is of interest in synthetic organic chemistry for its versatile reactivity.
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c1-12-8(11)7-4-6(5-10)2-3-9-7/h2-5H,1H3
InChI key:CIJCYKYLTLEDGS-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(ccn1)C=O
Found 5 products.