CAS 64464-07-9: Ethanamine, 2-(2-methoxyphenoxy)-, hydrochloride (1:1)
Description:Ethanamine, 2-(2-methoxyphenoxy)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and ether linkage. This substance features a 2-methoxyphenoxy group attached to an ethanamine backbone, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methoxy group can influence its biological activity and interaction with other molecules. Ethanolamine derivatives, such as this compound, are often studied for their potential roles in medicinal chemistry, including their effects on neurotransmitter systems. The compound's molecular structure suggests it may exhibit specific reactivity patterns, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H13NO2·ClH
InChI:InChI=1S/C9H13NO2.ClH/c1-11-8-4-2-3-5-9(8)12-7-6-10;/h2-5H,6-7,10H2,1H3;1H
InChI key:InChIKey=KNWPXZOMSZABHD-UHFFFAOYSA-N
SMILES:Cl.O(C=1C=CC=CC1OCCN)C
- Synonyms:
- 2-(2-Methoxy Phenoxy) Ethylamine hydrochloride
- 2-(2-Methoxyphenoxy)ethan-1-amine hydrochloride
- Ethanamine, 2-(2-methoxyphenoxy)-, hydrochloride
- Ethanamine, 2-(2-methoxyphenoxy)-, hydrochloride (1:1)
- Ethylamine, 2-(o-methoxyphenoxy)-, hydrochloride
- 2-(2-Methoxyphenoxy)ethylamine hydrochloride
