CAS 64474-51-7

Isomucronulatol

Description:

Isomucronulatol, with the CAS number 64474-51-7, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. This compound is characterized by its polyphenolic structure, which typically includes multiple hydroxyl groups that contribute to its antioxidant properties. Isomucronulatol is often studied for its potential effects in various biological systems, including anti-inflammatory and antimicrobial activities. It may also exhibit protective effects against oxidative stress, making it of interest in nutritional and pharmaceutical research. The compound is usually found in certain plant species, where it may play a role in plant defense mechanisms. As with many flavonoids, its solubility and stability can be influenced by environmental factors such as pH and temperature. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in health and medicine.

Formula: C₁₇H₁₈O₅

InChI: InChI=1S/C17H18O5/c1-20-14-6-5-13(16(19)17(14)21-2)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m0/s1

InChI key: InChIKey=NQRBAPDEZYMKFL-NSHDSACASA-N

SMILES: OC1=C([C@H]2CC=3C(OC2)=CC(O)=CC3)C=CC(OC)=C1OC

Synonyms:

• (-)-Isomucronulatol
• (3R)-3,4-Dihydro-3-(2-hydroxy-3,4-dimethoxyphenyl)-2H-1-benzopyran-7-ol
• (3R)-7,2′-Dihydroxy-3′,4′-dimethoxyisoflavan
• (R)-3-(2-Hydroxy-3,4-dimethoxyphenyl)chroman-7-ol
• 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(2-hydroxy-3,4-dimethoxyphenyl)-, (R)-
• 2H-1-benzopyran-7-ol, 3,4-dihydro-3-(2-hydroxy-3,4-dimethoxyphenyl)-, (3R)-

(R)-Isomucronulatol

CAS: 64474-51-7

(R)-Isomucronulatol, from Astragalus and others, may stop BMSC growth and death, suggesting anti-inflammatory properties.

Formula: C₁₇H₁₈O₅

Purity: 99.61%

Color and Shape: Solid

Molecular weight: 302.32

Ref: TM-TN6967

(R)-Isomucronulatol

CAS: 64474-51-7

(R)-Isomucronulatol

Purity: ≥98%

Molecular weight: 302.32g/mol

Ref: 54-BUP00438

Isomucronulatol

CAS: 64474-51-7

Formula: C₁₇H₁₈O₅

Purity: 95%~99%

Molecular weight: 302.326

Ref: BP-BP0096

Isomucronulatol

CAS: 64474-51-7

Isomucronulatol is a naturally occurring flavonoid compound, which is a secondary metabolite sourced primarily from various plant species. It exhibits significant antioxidant activity by scavenging free radicals and reducing oxidative stress, which can damage cellular components such as lipids, proteins, and DNA. Additionally, Isomucronulatol demonstrates anti-inflammatory effects by modulating signaling pathways involved in the inflammatory response, thereby reducing the production of pro-inflammatory cytokines.

Formula: C₁₇H₁₈O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 302.32 g/mol

Ref: 3D-XI161822