CAS 64479-55-6

3,5,12-trihydroxy-3-(1-hydroxyethyl)-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(formylamino)hexopyranoside

Description:

The chemical substance known as "3,5,12-trihydroxy-3-(1-hydroxyethyl)-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(formylamino)hexopyranoside," with the CAS number 64479-55-6, is a complex organic compound characterized by its intricate molecular structure. It features multiple hydroxyl groups, which contribute to its solubility and reactivity, as well as a methoxy group that can influence its chemical behavior and interactions. The presence of dioxo groups indicates potential reactivity, particularly in redox reactions. The hexahydrotetracene backbone suggests a polycyclic aromatic structure, which may impart unique optical and electronic properties. Additionally, the trideoxyhexopyranoside moiety indicates that the compound may exhibit biological activity, possibly interacting with biological systems or serving as a precursor for further chemical modifications. Overall, this compound's diverse functional groups and structural complexity suggest potential applications in pharmaceuticals, biochemistry, or materials science, although specific biological or chemical properties would require further investigation.

Formula: C₂₈H₃₁NO₁₁

InChI: InChI=1/C28H31NO11/c1-11-23(32)15(29-10-30)7-18(39-11)40-17-9-28(37,12(2)31)8-14-20(17)27(36)22-21(25(14)34)24(33)13-5-4-6-16(38-3)19(13)26(22)35/h4-6,10-12,15,17-18,23,31-32,34,36-37H,7-9H2,1-3H3,(H,29,30)

SMILES: CC1C(C(CC(O1)OC1CC(Cc2c1c(c1c(C(=O)c3cccc(c3C1=O)OC)c2O)O)(C(C)O)O)N=CO)O

Baumycin C2 (Mixture of Diastereomers)

CAS: 64479-55-6

Formula: C₂₈H₃₁NO₁₁

Color and Shape: Dark Red Solid

Molecular weight: 557.55

Ref: 4Z-D-4813

Baumycin C2

Controlled Product

CAS: 64479-55-6

Formula: C₂₈H₃₁NO₁₁

Color and Shape: Neat

Molecular weight: 557.546

Ref: TR-B118860

Baumycin C2

CAS: 64479-55-6

Baumycin C2 is an anthracycline antibiotic, which is a type of chemotherapy agent used in cancer treatment. This compound is derived from the bacterium Streptomyces, known for producing specific metabolites that interfere with cellular processes. The mode of action of Baumycin C2 involves intercalating into DNA, thereby disrupting the enzyme topoisomerase II. This interference prevents proper DNA replication and transcription, ultimately leading to apoptosis in rapidly dividing cancer cells. The uses and applications of Baumycin C2 predominantly relate to its efficacy against various types of cancers, including leukemias, lymphomas, and solid tumors such as breast cancer. By targeting DNA replication, Baumycin C2 plays a crucial role in reducing tumor growth and proliferation, representing a significant tool in oncological pharmacotherapy. Researchers continue to explore its potential in combination therapies to enhance its effectiveness and mitigate resistance.

Formula: C₂₈H₃₁NO₁₁

Purity: Min. 95%

Molecular weight: 557.5 g/mol

Ref: 3D-PCA47955

Baumycin C2 (Mixture of Diastereomers)

CAS: 64479-55-6

Formula: C₂₈H₃₁NO₁₁

Molecular weight: 557.55

Ref: ST-EA-CP-D104013