CAS 6448-14-2
:N-(3-{[(3-propoxybenzoyl)carbamothioyl]amino}phenyl)furan-2-carboxamide
Description:
N-(3-{[(3-propoxybenzoyl)carbamothioyl]amino}phenyl)furan-2-carboxamide, with the CAS number 6448-14-2, is a synthetic organic compound characterized by its complex structure, which includes a furan ring, an amide functional group, and a carbamothioyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the propoxy and benzoyl groups suggests that it may interact with biological targets, potentially influencing its pharmacological profile. Its structural features may also confer specific reactivity patterns, allowing for further chemical modifications. As with many compounds in medicinal chemistry, its efficacy and safety would need to be evaluated through rigorous testing. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in areas targeting specific biological pathways.
Formula:C22H21N3O4S
InChI:InChI=1/C22H21N3O4S/c1-2-11-28-18-9-3-6-15(13-18)20(26)25-22(30)24-17-8-4-7-16(14-17)23-21(27)19-10-5-12-29-19/h3-10,12-14H,2,11H2,1H3,(H,23,27)(H2,24,25,26,30)
SMILES:CCCOc1cccc(c1)C(=NC(=Nc1cccc(c1)NC(=O)c1ccco1)S)O
Synonyms:- 2-furancarboxamide, N-[3-[[[(3-propoxybenzoyl)amino]thioxomethyl]amino]phenyl]-
- N-(3-{[(3-Propoxybenzoyl)carbamothioyl]amino}phenyl)-2-furamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
