CAS 64481-12-5

6-chloro-3-formyl-7-methylchromone

Description:

6-Chloro-3-formyl-7-methylchromone is a chemical compound belonging to the chromone family, characterized by its fused benzopyran structure. This compound features a chloro substituent at the 6-position, a formyl group at the 3-position, and a methyl group at the 7-position of the chromone ring. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition, making it a versatile intermediate in organic synthesis. The chloro group can enhance the compound's reactivity and influence its biological activity. Chromones and their derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. The compound's unique structure may also contribute to its potential applications in medicinal chemistry and material science. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Proper handling and storage are essential to maintain its integrity and efficacy in research and application.

Formula: C₁₁H₇ClO₃

InChI: InChI=1/C11H7ClO3/c1-6-2-10-8(3-9(6)12)11(14)7(4-13)5-15-10/h2-5H,1H3

SMILES: Cc1cc2c(cc1Cl)c(=O)c(C=O)co2

Synonyms:

• 6-chloro-7-methyl-4-oxo-4H-chromene-3-carbaldehyde

6-Chloro-7-methyl-4-oxo-4H-chromene-3-carbaldehyde

CAS: 64481-12-5

Formula: C₁₁H₇ClO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.6245

Ref: IN-DA003N5S

6-Chloro-3-formyl-7-methylchromone

CAS: 64481-12-5

6-Chloro-3-formyl-7-methylchromone

Purity: 98%

Molecular weight: 222.62448g/mol

Ref: 54-OR1142

6-Chloro-3-formyl-7-methylchromone

CAS: 64481-12-5

Formula: C₁₁H₇ClO₃

Molecular weight: 222.62

Ref: 7W-GL4311

6-Chloro-7-methyl-3-formylchromone

CAS: 64481-12-5

6-Chloro-7-methyl-3-formylchromone is a magnetic nanoparticle that can be used in the detection of coordination compounds. The coordination compound is first reduced to form the corresponding phosphoryl complex, which is then detected by the change in color and intensity of the magnetic nanoparticles. This reaction is linear over a wide range of concentrations and pH values and does not require additional reagents or solvents. The colorimetric method for this reaction has been shown to be effective for detecting ursolic acid, zirconium, gold nanoparticles, and linear ranges.br>br>
The phosphatase PTP1B enzyme is responsible for regulating glucose levels in cells. It has been shown that 6-chloro-7-methyl-3-formylchromone inhibits PTP1B activity by dephosphorylation at cysteine residues. This inhibition leads to increased glucose uptake and decreased insulin release from pancreatic beta cells

Formula: C₁₁H₇ClO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 222.62 g/mol

Ref: 3D-FC53829