CymitQuimica logo

CAS 644972-57-6

:

pyrrolidine-3-carboxamide hydrochloride

Description:
Pyrrolidine-3-carboxamide hydrochloride is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, contributing to its solubility in polar solvents, particularly water. As a hydrochloride salt, it is typically encountered in a crystalline form, enhancing its stability and ease of handling. Pyrrolidine-3-carboxamide hydrochloride is of interest in various fields, including medicinal chemistry, due to its potential biological activity and applications in drug development. The presence of the carboxamide group may influence its interactions with biological targets, making it a subject of research for therapeutic uses. Additionally, its molecular properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other substances. As with any chemical, proper safety measures should be observed when handling this compound, including the use of personal protective equipment and adherence to relevant safety protocols.
Formula:C5H11ClN2O
InChI:InChI=1S/C5H10N2O.ClH/c6-5(8)4-1-2-7-3-4;/h4,7H,1-3H2,(H2,6,8);1H
InChI key:GCPFRHSIYOIWDY-UHFFFAOYSA-N
SMILES:C1CNCC1C(=O)N.Cl
Synonyms:
  • 3-Pyrrolidinecarboxamide HCl
  • 3-Pyrrolidinecarboxamide Hydrochloride
Found 5 products.