CAS 645-54-5
:2-Phenylthioacetamide
Description:
2-Phenylthioacetamide is an organic compound characterized by its thioamide functional group, which features a sulfur atom bonded to a carbonyl carbon. Its molecular structure includes a phenyl group attached to a sulfur atom, which is further connected to an acetamide moiety. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. It has applications in organic synthesis and can serve as a building block in the preparation of various pharmaceuticals and agrochemicals. The presence of the thioamide group imparts unique reactivity, making it useful in various chemical transformations. Additionally, 2-Phenylthioacetamide may exhibit biological activity, which warrants consideration in toxicological assessments. As with many chemical substances, proper handling and safety precautions are essential due to potential health hazards associated with exposure. Overall, 2-Phenylthioacetamide is a versatile compound with significant relevance in both industrial and research settings.
Formula:C8H9NS
InChI:InChI=1/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10)
SMILES:c1ccc(cc1)CC(=N)S
Synonyms:- Benzeneethanethioamide
- 2-Phenylethanethioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Phenylthioacetamide, 97%
CAS:2-Phenylthioacetamide find extensive use in organic synthesis. N-bromo and N-chloro succinimides are halogenating agents. Phthalimides are used in the synthesis of primary amines. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentatiFormula:C8H9NSPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:151.232-Phenylthioacetamide
CAS:Formula:C8H9NSPurity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:151.23




