CAS 645-83-0
:3-(Methylsulfonyl)propanoic acid
Description:
3-(Methylsulfonyl)propanoic acid, with the CAS number 645-83-0, is an organic compound characterized by the presence of a propanoic acid backbone substituted with a methylsulfonyl group. This compound features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in water and polar solvents. The methylsulfonyl group (-SO2CH3) enhances its reactivity and can influence its biological activity, potentially serving as a pharmacophore in medicinal chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Additionally, its structural characteristics may contribute to its role in biochemical pathways, although specific biological activities can vary. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H8O4S
InChI:InChI=1S/C4H8O4S/c1-9(7,8)3-2-4(5)6/h2-3H2,1H3,(H,5,6)
InChI key:InChIKey=ODUCCTTZGHSNKX-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)CC(O)=O
Synonyms:- Propionic acid, 3-(methylsulfonyl)-
- 3-(Methylsulfonyl)propionic acid
- 3-(Methylsulfonyl)propanoic acid
- Propanoic acid, 3-(methylsulfonyl)-
- 3-Methanesulfonylpropanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(METHYLSULFONYL)PROPANOIC ACID
CAS:Formula:C4H8O4SPurity:97%Color and Shape:SolidMolecular weight:152.16893-(Methylsulfonyl)propanoic acid
CAS:<p>3-(Methylsulfonyl)propanoic acid</p>Purity:97%Molecular weight:152.17g/mol3-(methylsulfonyl)propanoic acid
CAS:Formula:C4H8O4SPurity:97%Color and Shape:Beige powderMolecular weight:152.163-(Methylsulfonyl)propanoic acid
CAS:<p>3-(Methylsulfonyl)propanoic acid is a polynucleotide that is used in sequencing reactions. It has been shown to bind to the protein Smegmatis and increase the rate of the polymer composition. 3-(Methylsulfonyl)propanoic acid has also been shown to have a structural similarity with porins, which are proteins that form pores in cell membranes for ion transport. 3-methylsulfanylpropanoic acid binds to porins by coordinating geometry, allowing it to be transported into cells. The 6-Fluoro-3-indoxyl-beta-D-galactopyranoside is an antituberculosis drug that belongs to the class of rifamycins. Rifapentine inhibits bacterial growth by binding to DNA-dependent RNA polymerase, thereby preventing transcription and replication. The high frequency of human activity has been shown using a patch-clamp technique on human ery</p>Formula:C4H8O4SPurity:Min. 95%Molecular weight:152.17 g/mol



