CAS 64505-10-8
:Ethyl 2-isocyanato-4-methylvalerate
Description:
Ethyl 2-isocyanato-4-methylvalerate, with the CAS number 64505-10-8, is an organic compound characterized by the presence of an isocyanate functional group and an ester moiety. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Ethyl 2-isocyanato-4-methylvalerate is known for its reactivity, particularly in nucleophilic addition reactions, which makes it valuable in the synthesis of various polymers and pharmaceuticals. The isocyanate group is highly reactive, allowing for the formation of ureas and other derivatives when it interacts with amines or alcohols. Safety precautions are essential when handling this compound, as isocyanates can be irritants and pose health risks upon exposure. Proper storage in a cool, dry place, away from moisture and incompatible substances, is crucial to maintain its stability and prevent hazardous reactions.
Formula:C9H15NO3
InChI:InChI=1/C9H15NO3/c1-4-13-9(12)8(10-6-11)5-7(2)3/h7-8H,4-5H2,1-3H3
SMILES:CCOC(=O)C(CC(C)C)N=C=O
Synonyms:- Ethyl 2-isocyanato-4-methylpentanoate~2-Isocyanato-4-methylvaleric acid ethyl ester
- ethyl N-(oxomethylidene)leucinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
