CAS 6451-73-6
:Scoulerine
Description:
Scoulerine is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the family Papaveraceae. It is characterized by its complex tetracyclic structure, which includes a benzylisoquinoline framework. Scoulerine exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it a subject of interest in pharmacological research. The compound is typically found in the form of a white to pale yellow crystalline solid and is soluble in organic solvents like ethanol and methanol, but has limited solubility in water. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and nitrogen atoms, contributing to its unique chemical properties. Scoulerine's pharmacokinetics and mechanisms of action are still under investigation, but its potential therapeutic applications continue to drive research in medicinal chemistry and natural product studies. As with many alkaloids, caution is advised regarding its use, as it may exhibit toxicity at certain concentrations.
Formula:C19H21NO4
InChI:InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1
InChI key:InChIKey=KNWVMRVOBAFFMH-HNNXBMFYSA-N
SMILES:OC=1C=C2[C@]3(N(CC=4C(C3)=CC=C(OC)C4O)CCC2=CC1OC)[H]
Synonyms:- 6H-Dibenzo[a,g]quinolizine-2,9-diol, 5,8,13,13a-tetrahydro-3,10-dimethoxy-, (13aS)-
- Scoulerine
- 6H-Dibenzo[a,g]quinolizine-2,9-diol, 5,8,13,13a-tetrahydro-3,10-dimethoxy-, (S)-
- (13aS)-5,8,13,13a-Tetrahydro-3,10-dimethoxy-6H-dibenzo[a,g]quinolizine-2,9-diol
- 13aα-Berbine-2,9-diol, 3,10-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Scoulerine
CAS:Scoulerine is an inhibitor of ß-site amyloid precursor protein cleaving enzyme 1(BACE1).Formula:C19H21NO4Purity:98.62%Color and Shape:SolidMolecular weight:327.37(-)-Scoulerin
CAS:(-)-Scoulerin is a benzylisoquinoline alkaloid, which is a natural compound derived primarily from various plant sources, particularly within the Berberidaceae and Ranunculaceae families. The mode of action of (-)-Scoulerin involves interacting with various enzymes and receptors, contributing to its antimicrobial, anti-inflammatory, and antioxidant properties. Research indicates that (-)-Scoulerin can inhibit the activity of topoisomerases and monoamine oxidases, thereby impacting crucial cellular processes and neurotransmitter regulation.Formula:C19H21NO4Purity:Min. 96 Area-%Molecular weight:327.37 g/molS-Scoulerine
CAS:S-Scoulerine is an isoquinoline alkaloid, which is a bioactive compound sourced from various plants, notably within the Berberidaceae family. This naturally occurring substance functions primarily as a modulator of biological pathways, exerting effects on several cellular processes through its interaction with enzymes and receptors involved in signal transduction.
Formula:C19H21NO4Color and Shape:PowderMolecular weight:327.37 g/mol






