CAS 6451-73-6: Scoulerine
Description:Scoulerine is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the family Papaveraceae. It is characterized by its complex tetracyclic structure, which includes a benzylisoquinoline framework. Scoulerine exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it a subject of interest in pharmacological research. The compound is typically found in the form of a white to pale yellow crystalline solid and is soluble in organic solvents like ethanol and methanol, but has limited solubility in water. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and nitrogen atoms, contributing to its unique chemical properties. Scoulerine's pharmacokinetics and mechanisms of action are still under investigation, but its potential therapeutic applications continue to drive research in medicinal chemistry and natural product studies. As with many alkaloids, caution is advised regarding its use, as it may exhibit toxicity at certain concentrations.
Formula:C19H21NO4
InChI:InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1
InChI key:InChIKey=KNWVMRVOBAFFMH-HNNXBMFYSA-N
SMILES:OC=1C=C2C(=CC1OC)CCN3CC4=C(O)C(OC)=CC=C4CC23
- Synonyms:
- 6H-Dibenzo[a,g]quinolizine-2,9-diol, 5,8,13,13a-tetrahydro-3,10-dimethoxy-, (13aS)-
- Scoulerine
- 6H-Dibenzo[a,g]quinolizine-2,9-diol, 5,8,13,13a-tetrahydro-3,10-dimethoxy-, (S)-
- (13aS)-5,8,13,13a-Tetrahydro-3,10-dimethoxy-6H-dibenzo[a,g]quinolizine-2,9-diol
- 13aα-Berbine-2,9-diol, 3,10-dimethoxy-
