CymitQuimica logo

CAS 6452-15-9

:

(3E)-1-methyl-1H-indole-2,3-dione 3-(N,N-diethylthiosemicarbazone)

Description:
(3E)-1-methyl-1H-indole-2,3-dione 3-(N,N-diethylthiosemicarbazone), with CAS number 6452-15-9, is a chemical compound that belongs to the class of thiosemicarbazones, which are derivatives of thiosemicarbazide. This compound features an indole structure, characterized by a fused benzene and pyrrole ring, and contains a methyl group and a thiosemicarbazone moiety. The thiosemicarbazone part contributes to its potential biological activity, as thiosemicarbazones are known for their roles in medicinal chemistry, particularly in the development of anti-cancer and anti-microbial agents. The compound may exhibit properties such as chelation of metal ions, which can influence its reactivity and biological interactions. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, this compound is of interest in research for its potential applications in pharmaceuticals and biochemistry, although specific biological activities and mechanisms would require further investigation.
Formula:C14H18N4OS
InChI:InChI=1/C14H18N4OS/c1-4-18(5-2)14(20)16-15-12-10-8-6-7-9-11(10)17(3)13(12)19/h6-9H,4-5H2,1-3H3,(H,16,20)/b15-12+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.