CAS 64526-29-0
:7-(beta-D-xylofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:
7-(beta-D-xylofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-d]pyrimidine core fused with a beta-D-xylofuranosyl moiety. This compound features a pyrimidine ring that is substituted at the 4-position with an amine group, contributing to its potential biological activity. The presence of the xylofuranosyl group suggests that it may interact with biological systems, particularly in nucleic acid chemistry or as a potential nucleoside analog. The compound's molecular structure indicates it may exhibit properties relevant to medicinal chemistry, including potential antiviral or anticancer activities. Its CAS number, 64526-29-0, allows for easy identification in chemical databases. As with many compounds of this nature, further studies would be necessary to fully elucidate its pharmacological properties, mechanisms of action, and potential applications in drug development.
Formula:C11H14N4O4
InChI:InChI=1/C11H14N4O4/c12-9-5-1-2-15(10(5)14-4-13-9)11-8(18)7(17)6(3-16)19-11/h1-2,4,6-8,11,16-18H,3H2,(H2,12,13,14)/t6-,7+,8-,11-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Xylotubercidin
CAS:Xylotubercidin is a biochemical.Formula:C11H14N4O4Color and Shape:SolidMolecular weight:266.25Xylotuberin
CAS:Controlled ProductApplications Xylotuberin displays inhibitory effects against respiratory syncytial virus replication.
References Kawana, F. et al.: Antimicrob. Agents Chemother., 31, 1225 (1987);Formula:C11H14N4O4Color and Shape:NeatMolecular weight:266.253Xylotuberin
CAS:Xylotuberin is a natural compound, which is a bioactive product derived from specific fungal species with unique enzymatic properties. It is sourced from specialized fungal cultures known for their ability to produce specific secondary metabolites. The mode of action of Xylotuberin involves enzymatic activity that facilitates the breakdown of complex polysaccharides into simpler sugars. This enzymatic property makes it highly valuable for various biotechnological and industrial processes.
Formula:C11H14N4O4Purity:Min. 95%Molecular weight:266.25 g/mol


