CAS 64527-04-4
:(2S,5R,6R)-6-(Formylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Description:
The chemical substance known as (2S,5R,6R)-6-(Formylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, with the CAS number 64527-04-4, is a bicyclic compound featuring a thiazolidine ring structure. This compound is characterized by the presence of multiple functional groups, including a formylamino group and a carboxylic acid, which contribute to its reactivity and potential biological activity. The stereochemistry indicated by the (2S,5R,6R) configuration suggests specific spatial arrangements of atoms that can influence the compound's interactions with biological targets. The presence of a keto group and the bicyclic framework may also suggest potential applications in medicinal chemistry, particularly in the development of antibiotics or other therapeutic agents. Additionally, the compound's unique structural features may affect its solubility, stability, and overall pharmacokinetic properties, making it a subject of interest for further research in organic and medicinal chemistry.
Formula:C9H12N2O4S
InChI:InChI=1S/C9H12N2O4S/c1-9(2)5(8(14)15)11-6(13)4(10-3-12)7(11)16-9/h3-5,7H,1-2H3,(H,10,12)(H,14,15)/t4-,5+,7-/m1/s1
InChI key:InChIKey=MDQGTDMBVJCTBN-JCGDXUMPSA-N
SMILES:C(O)(=O)[C@@H]1N2[C@@]([C@H](NC=O)C2=O)(SC1(C)C)[H]
Synonyms:- (2S,5R,6R)-6-(Formylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-(formylamino)-3,3-dimethyl-7-oxo-, (2S,5R,6R)-
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-(formylamino)-3,3-dimethyl-7-oxo-, [2S-(2α,5α,6β)]-
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylicacid, 6-(formylamino)-3,3-dimethyl-7-oxo-, [2S-(2a,5a,6b)]-
- 6-Formamidopenicillanic acid
- 6-Formamidopenicillanicacid
- Pab 141
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Formamidopenicillanic acid
CAS:<p>6-Formamidopenicillanic acid is a derivative of formamide, which is a chloral. It can be prepared by hydrolysis of formamide with hydrochloric acid and sodium hydroxide. 6-Formamidopenicillanic acid can also be synthesized by reacting formaldehyde with ammonia in the presence of hydrogen chloride. This compound is used as a disinfectant and has been shown to be effective against gram-negative bacteria such as Escherichia coli, Enterobacter aerogenes, Citrobacter freundii, Klebsiella pneumoniae, Proteus vulgaris, Salmonella enteritidis, Serratia marcescens, Shigella flexneri, and Yersinia enterocolitica. 6-Formamidopenicillanic acid is also an analog of penicillin that has been shown to have an increased degree of activity against methicillin-resistant Staphylococcus aure</p>Formula:C9H12N2O4SPurity:Min. 95%Molecular weight:244.27 g/mol

