CymitQuimica logo

CAS 64542-91-2

:

2-(benzylsulfanyl)-5H-purin-6-amine

Description:
2-(Benzylsulfanyl)-5H-purin-6-amine, with the CAS number 64542-91-2, is a purine derivative characterized by the presence of a benzylsulfanyl group and an amine functional group. This compound features a purine core, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, making it a member of the nucleobase family. The benzylsulfanyl substituent introduces a sulfur atom linked to a benzyl group, which can influence the compound's solubility, reactivity, and biological activity. The amine group contributes to its potential as a ligand in various chemical reactions and biological interactions. This compound may exhibit interesting pharmacological properties, potentially acting as an inhibitor or modulator in biochemical pathways. Its structural features suggest that it could be investigated for applications in medicinal chemistry, particularly in the development of therapeutics targeting purine-related pathways. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental conditions such as pH, temperature, and the presence of other chemical species.
Formula:C12H11N5S
InChI:InChI=1/C12H11N5S/c13-10-9-11(15-7-14-9)17-12(16-10)18-6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H2,13,14,15,16,17)
InChI key:REPIAJURENEHOZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CSC1=NC(=N)C2C(=NC=N2)N1
Found 3 products.